C12H11Br2N3S — CID 115381230
5-bromo-2-(3-bromothiophen-2-yl)-6-cyclopropyl-N-methylpyrimidin-4-amine (PubChem CID 115381230) has the molecular formula C12H11Br2N3S and a molecular weight of 389.12 g/mol. Its IUPAC name is 5-bromo-2-(3-bromothiophen-2-yl)-6-cyclopropyl-N-methylpyrimidin-4-amine.
| Compound Name | 5-bromo-2-(3-bromothiophen-2-yl)-6-cyclopropyl-N-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 115381230 |
| Molecular Formula | C12H11Br2N3S |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 386.90 |
| IUPAC Name | 5-bromo-2-(3-bromothiophen-2-yl)-6-cyclopropyl-N-methylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2sccc2Br)nc(C2CC2)c1Br |
| InChI | InChI=1S/C12H11Br2N3S/c1-15-11-8(14)9(6-2-3-6)16-12(17-11)10-7(13)4-5-18-10/h4-6H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | VBXQNAUCPPMWFO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |