C13H12BrN3S — CID 107355274
6-(4-bromothiophen-2-yl)-2-(propylamino)pyridine-3-carbonitrile (PubChem CID 107355274) has the molecular formula C13H12BrN3S and a molecular weight of 322.23 g/mol. Its IUPAC name is 6-(4-bromothiophen-2-yl)-2-(propylamino)pyridine-3-carbonitrile.
| Compound Name | 6-(4-bromothiophen-2-yl)-2-(propylamino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 107355274 |
| Molecular Formula | C13H12BrN3S |
| Molecular Weight | 322.23 g/mol |
| Exact Mass | 320.99 |
| IUPAC Name | 6-(4-bromothiophen-2-yl)-2-(propylamino)pyridine-3-carbonitrile |
| SMILES | CCCNc1nc(-c2cc(Br)cs2)ccc1C#N |
| InChI | InChI=1S/C13H12BrN3S/c1-2-5-16-13-9(7-15)3-4-11(17-13)12-6-10(14)8-18-12/h3-4,6,8H,2,5H2,1H3,(H,16,17) |
| InChIKey | IVFFUJLLJZYRGV-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |