C11H12N4O — CID 116822998
6-(4-ethoxyphenyl)-1,2,4-triazin-5-amine (PubChem CID 116822998) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-1,2,4-triazin-5-amine.
| Compound Name | 6-(4-ethoxyphenyl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 116822998 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 6-(4-ethoxyphenyl)-1,2,4-triazin-5-amine |
| SMILES | CCOc1ccc(-c2nncnc2N)cc1 |
| InChI | InChI=1S/C11H12N4O/c1-2-16-9-5-3-8(4-6-9)10-11(12)13-7-14-15-10/h3-7H,2H2,1H3,(H2,12,13,14) |
| InChIKey | FSLHLZSIHRAEOO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |