C15H14F3NO2 — CID 144561636
4,5-difluoro-6-(4-methoxyphenyl)pyridine-2-carbonyl fluoride;ethane (PubChem CID 144561636) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 4,5-difluoro-6-(4-methoxyphenyl)pyridine-2-carbonyl fluoride;ethane.
| Compound Name | 4,5-difluoro-6-(4-methoxyphenyl)pyridine-2-carbonyl fluoride;ethane |
|---|---|
| PubChem CID | 144561636 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 4,5-difluoro-6-(4-methoxyphenyl)pyridine-2-carbonyl fluoride;ethane |
| SMILES | CC.COc1ccc(-c2nc(C(=O)F)cc(F)c2F)cc1 |
| InChI | InChI=1S/C13H8F3NO2.C2H6/c1-19-8-4-2-7(3-5-8)12-11(15)9(14)6-10(17-12)13(16)18;1-2/h2-6H,1H3;1-2H3 |
| InChIKey | WJFXCVHLEYDMBY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|