C16H10F3N3O3 — CID 56768767
5-(4-methoxyphenyl)-1-(3,4,5-trifluorophenyl)triazole-4-carboxylic acid (PubChem CID 56768767) has the molecular formula C16H10F3N3O3 and a molecular weight of 349.27 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-1-(3,4,5-trifluorophenyl)triazole-4-carboxylic acid.
| Compound Name | 5-(4-methoxyphenyl)-1-(3,4,5-trifluorophenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56768767 |
| Molecular Formula | C16H10F3N3O3 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-(4-methoxyphenyl)-1-(3,4,5-trifluorophenyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(-c2c(C(=O)O)nnn2-c2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C16H10F3N3O3/c1-25-10-4-2-8(3-5-10)15-14(16(23)24)20-21-22(15)9-6-11(17)13(19)12(18)7-9/h2-7H,1H3,(H,23,24) |
| InChIKey | WKHIEBYVPYZATM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|