C17H14FN3O3 — CID 56768881
1-(3-fluoro-4-methoxyphenyl)-5-(4-methylphenyl)triazole-4-carboxylic acid (PubChem CID 56768881) has the molecular formula C17H14FN3O3 and a molecular weight of 327.32 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-5-(4-methylphenyl)triazole-4-carboxylic acid.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-5-(4-methylphenyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 56768881 |
| Molecular Formula | C17H14FN3O3 |
| Molecular Weight | 327.32 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-5-(4-methylphenyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2nnc(C(=O)O)c2-c2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C17H14FN3O3/c1-10-3-5-11(6-4-10)16-15(17(22)23)19-20-21(16)12-7-8-14(24-2)13(18)9-12/h3-9H,1-2H3,(H,22,23) |
| InChIKey | CRDPUYBGPYZHMU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |