About 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid
1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid (PubChem CID 73333195) has the molecular formula C19H19N3O6
and a molecular weight of 385.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid |
| PubChem CID | 73333195 |
| Molecular Formula | C19H19N3O6 |
| Molecular Weight | 385.38 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(-n2nnc(C(=O)O)c2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H19N3O6/c1-25-13-7-5-12(6-8-13)22-17(16(19(23)24)20-21-22)11-9-14(26-2)18(28-4)15(10-11)27-3/h5-10H,1-4H3,(H,23,24) |
| InChIKey | OXFHSVYQNFVGTK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid?
The IUPAC name of 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid (CID 73333195) is 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid.
What is the SMILES notation for 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid?
The canonical SMILES for 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid is COc1ccc(-n2nnc(C(=O)O)c2-c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid?
The InChIKey is OXFHSVYQNFVGTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O6/c1-25-13-7-5-12(6-8-13)22-17(16(19(23)24)20-21-22)11-9-14(26-2)18(28-4)15(10-11)27-3/h5-10H,1-4H3,(H,23,24).
What are the key properties of 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid?
1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid has a molecular weight of 385.38 g/mol, XLogP of 2.67, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazole-4-carboxylic acid is sourced from PubChem (CID 73333195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).