C26H23N3O2S — CID 87836550
[4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-(1H-indol-2-yl)methanethiol (PubChem CID 87836550) has the molecular formula C26H23N3O2S and a molecular weight of 441.56 g/mol. Its IUPAC name is [4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-(1H-indol-2-yl)methanethiol.
| Compound Name | [4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-(1H-indol-2-yl)methanethiol |
|---|---|
| PubChem CID | 87836550 |
| Molecular Formula | C26H23N3O2S |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | [4,5-bis(4-methoxyphenyl)-1H-imidazol-2-yl]-(1H-indol-2-yl)methanethiol |
| SMILES | COc1ccc(-c2nc(C(S)c3cc4ccccc4[nH]3)[nH]c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H23N3O2S/c1-30-19-11-7-16(8-12-19)23-24(17-9-13-20(31-2)14-10-17)29-26(28-23)25(32)22-15-18-5-3-4-6-21(18)27-22/h3-15,25,27,32H,1-2H3,(H,28,29) |
| InChIKey | IKLSTHXIEYKFJT-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 62.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|