C19H18F3N3O4 — CID 139062664
1,4-bis(3,4-dimethoxyphenyl)-5-(trifluoromethyl)triazole (PubChem CID 139062664) has the molecular formula C19H18F3N3O4 and a molecular weight of 409.36 g/mol. Its IUPAC name is 1,4-bis(3,4-dimethoxyphenyl)-5-(trifluoromethyl)triazole.
| Compound Name | 1,4-bis(3,4-dimethoxyphenyl)-5-(trifluoromethyl)triazole |
|---|---|
| PubChem CID | 139062664 |
| Molecular Formula | C19H18F3N3O4 |
| Molecular Weight | 409.36 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 1,4-bis(3,4-dimethoxyphenyl)-5-(trifluoromethyl)triazole |
| SMILES | COc1ccc(-c2nnn(-c3ccc(OC)c(OC)c3)c2C(F)(F)F)cc1OC |
| InChI | InChI=1S/C19H18F3N3O4/c1-26-13-7-5-11(9-15(13)28-3)17-18(19(20,21)22)25(24-23-17)12-6-8-14(27-2)16(10-12)29-4/h5-10H,1-4H3 |
| InChIKey | SLFSGUUWPJVJIE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |