About 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine
5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine (PubChem CID 2053193) has the molecular formula C17H15F3N4O2
and a molecular weight of 364.33 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine.
Molecular Properties
| Compound Name | 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine |
| PubChem CID | 2053193 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine |
| SMILES | COc1ccc(-c2nnn(-c3cccc(C(F)(F)F)c3)c2N)cc1OC |
| InChI | InChI=1S/C17H15F3N4O2/c1-25-13-7-6-10(8-14(13)26-2)15-16(21)24(23-22-15)12-5-3-4-11(9-12)17(18,19)20/h3-9H,21H2,1-2H3 |
| InChIKey | RGTNFZXMJTZVQL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine?
The IUPAC name of 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine (CID 2053193) is 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine.
What is the SMILES notation for 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine?
The canonical SMILES for 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine is COc1ccc(-c2nnn(-c3cccc(C(F)(F)F)c3)c2N)cc1OC.
What is the InChIKey of 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine?
The InChIKey is RGTNFZXMJTZVQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F3N4O2/c1-25-13-7-6-10(8-14(13)26-2)15-16(21)24(23-22-15)12-5-3-4-11(9-12)17(18,19)20/h3-9H,21H2,1-2H3.
What are the key properties of 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine?
5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine has a molecular weight of 364.33 g/mol, XLogP of 3.55, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dimethoxyphenyl)-3-[3-(trifluoromethyl)phenyl]triazol-4-amine is sourced from PubChem (CID 2053193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).