C18H20N4O4 — CID 73333291
1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazol-4-amine (PubChem CID 73333291) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazol-4-amine.
| Compound Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazol-4-amine |
|---|---|
| PubChem CID | 73333291 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-(4-methoxyphenyl)-5-(3,4,5-trimethoxyphenyl)triazol-4-amine |
| SMILES | COc1ccc(-n2nnc(N)c2-c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C18H20N4O4/c1-23-13-7-5-12(6-8-13)22-16(18(19)20-21-22)11-9-14(24-2)17(26-4)15(10-11)25-3/h5-10H,19H2,1-4H3 |
| InChIKey | VFOXVLIPSYMQEK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |