C23H28O7 — CID 101477397
5-[(2R,3S,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-bis(methoxymethyl)oxolan-2-yl]-1,3-benzodioxole (PubChem CID 101477397) has the molecular formula C23H28O7 and a molecular weight of 416.47 g/mol. Its IUPAC name is 5-[(2R,3S,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-bis(methoxymethyl)oxolan-2-yl]-1,3-benzodioxole.
| Compound Name | 5-[(2R,3S,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-bis(methoxymethyl)oxolan-2-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 101477397 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 5-[(2R,3S,4S,5R)-5-(3,4-dimethoxyphenyl)-3,4-bis(methoxymethyl)oxolan-2-yl]-1,3-benzodioxole |
| SMILES | COC[C@@H]1[C@@H](COC)[C@H](c2ccc3c(c2)OCO3)O[C@H]1c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H28O7/c1-24-11-16-17(12-25-2)23(15-6-8-19-21(10-15)29-13-28-19)30-22(16)14-5-7-18(26-3)20(9-14)27-4/h5-10,16-17,22-23H,11-13H2,1-4H3/t16-,17-,22+,23+/m1/s1 |
| InChIKey | OGTJJRNJLHLKFF-AFXFGAOOSA-N |
| XLogP | 3.77 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |