C22H26O5 — CID 162941534
6-[(2R,3R,4R,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 162941534) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is 6-[(2R,3R,4R,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[(2R,3R,4R,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 162941534 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 6-[(2R,3R,4R,5S)-5-(3,4-dimethoxyphenyl)-3,4-dimethyloxolan-2-yl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | COc1ccc([C@H]2O[C@@H](c3ccc4c(c3)OCCO4)[C@H](C)[C@H]2C)cc1OC |
| InChI | InChI=1S/C22H26O5/c1-13-14(2)22(16-6-8-18-20(12-16)26-10-9-25-18)27-21(13)15-5-7-17(23-3)19(11-15)24-4/h5-8,11-14,21-22H,9-10H2,1-4H3/t13-,14-,21+,22-/m1/s1 |
| InChIKey | BBSVRRFIUUMCCG-JZCAMDEDSA-N |
| XLogP | 4.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |