C14H13IO4 — CID 100983307
(3S,4R,5R)-4-(1,3-benzodioxol-5-yl)-3-ethenyl-5-(iodomethyl)oxolan-2-one (PubChem CID 100983307) has the molecular formula C14H13IO4 and a molecular weight of 372.16 g/mol. Its IUPAC name is (3S,4R,5R)-4-(1,3-benzodioxol-5-yl)-3-ethenyl-5-(iodomethyl)oxolan-2-one.
| Compound Name | (3S,4R,5R)-4-(1,3-benzodioxol-5-yl)-3-ethenyl-5-(iodomethyl)oxolan-2-one |
|---|---|
| PubChem CID | 100983307 |
| Molecular Formula | C14H13IO4 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | (3S,4R,5R)-4-(1,3-benzodioxol-5-yl)-3-ethenyl-5-(iodomethyl)oxolan-2-one |
| SMILES | C=C[C@@H]1C(=O)O[C@@H](CI)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H13IO4/c1-2-9-13(12(6-15)19-14(9)16)8-3-4-10-11(5-8)18-7-17-10/h2-5,9,12-13H,1,6-7H2/t9-,12-,13-/m0/s1 |
| InChIKey | QAAAGANJDIQIMQ-XDTLVQLUSA-N |
| XLogP | 2.66 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|