C24H30O5 — CID 92529380
(4aS,8aS,9aR,10aR)-9-(1,3-benzodioxol-5-yl)-3,3,6,6-tetramethyl-4,4a,5,7,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione (PubChem CID 92529380) has the molecular formula C24H30O5 and a molecular weight of 398.50 g/mol. Its IUPAC name is (4aS,8aS,9aR,10aR)-9-(1,3-benzodioxol-5-yl)-3,3,6,6-tetramethyl-4,4a,5,7,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione.
| Compound Name | (4aS,8aS,9aR,10aR)-9-(1,3-benzodioxol-5-yl)-3,3,6,6-tetramethyl-4,4a,5,7,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 92529380 |
| Molecular Formula | C24H30O5 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (4aS,8aS,9aR,10aR)-9-(1,3-benzodioxol-5-yl)-3,3,6,6-tetramethyl-4,4a,5,7,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)[C@@H]2C(c3ccc4c(c3)OCO4)[C@@H]3C(=O)CC(C)(C)C[C@H]3O[C@H]2C1 |
| InChI | InChI=1S/C24H30O5/c1-23(2)8-14(25)21-18(10-23)29-19-11-24(3,4)9-15(26)22(19)20(21)13-5-6-16-17(7-13)28-12-27-16/h5-7,18-22H,8-12H2,1-4H3/t18-,19+,20?,21-,22+ |
| InChIKey | VZSHNZIJGWRJFJ-WRBWDUGDSA-N |
| XLogP | 4.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |