C15H19NO3 — CID 55082335
8-(1,3-benzodioxol-5-yl)-9-oxa-6-azaspiro[4.5]decane (PubChem CID 55082335) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 8-(1,3-benzodioxol-5-yl)-9-oxa-6-azaspiro[4.5]decane.
| Compound Name | 8-(1,3-benzodioxol-5-yl)-9-oxa-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 55082335 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 8-(1,3-benzodioxol-5-yl)-9-oxa-6-azaspiro[4.5]decane |
| SMILES | c1cc2c(cc1C1CNC3(CCCC3)CO1)OCO2 |
| InChI | InChI=1S/C15H19NO3/c1-2-6-15(5-1)9-17-14(8-16-15)11-3-4-12-13(7-11)19-10-18-12/h3-4,7,14,16H,1-2,5-6,8-10H2 |
| InChIKey | WGMUTLBALDJOLA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |