About 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane (PubChem CID 62521799) has the molecular formula C17H23NO3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane |
| PubChem CID | 62521799 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane |
| SMILES | c1cc2c(cc1C1CNC3(CCCCC3)CO1)OCCO2 |
| InChI | InChI=1S/C17H23NO3/c1-2-6-17(7-3-1)12-21-16(11-18-17)13-4-5-14-15(10-13)20-9-8-19-14/h4-5,10,16,18H,1-3,6-9,11-12H2 |
| InChIKey | VRLKBBKPWVWENV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane?
The IUPAC name of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane (CID 62521799) is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane.
What is the SMILES notation for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane?
The canonical SMILES for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane is c1cc2c(cc1C1CNC3(CCCCC3)CO1)OCCO2.
What is the InChIKey of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane?
The InChIKey is VRLKBBKPWVWENV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO3/c1-2-6-17(7-3-1)12-21-16(11-18-17)13-4-5-14-15(10-13)20-9-8-19-14/h4-5,10,16,18H,1-3,6-9,11-12H2.
What are the key properties of 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane?
3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane has a molecular weight of 289.38 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-oxa-1-azaspiro[5.5]undecane is sourced from PubChem (CID 62521799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).