C15H19NO3 — CID 63297544
2-cyclopropyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine (PubChem CID 63297544) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 2-cyclopropyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine.
| Compound Name | 2-cyclopropyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine |
|---|---|
| PubChem CID | 63297544 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 2-cyclopropyl-6-(2,3-dihydro-1,4-benzodioxin-6-yl)morpholine |
| SMILES | c1cc2c(cc1C1CNCC(C3CC3)O1)OCCO2 |
| InChI | InChI=1S/C15H19NO3/c1-2-10(1)14-8-16-9-15(19-14)11-3-4-12-13(7-11)18-6-5-17-12/h3-4,7,10,14-16H,1-2,5-6,8-9H2 |
| InChIKey | GPKNXBQHRLRXIS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |