C17H25NO3 — CID 106352847
5-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-oxazepane (PubChem CID 106352847) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 5-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-oxazepane.
| Compound Name | 5-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 106352847 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 5-tert-butyl-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-oxazepane |
| SMILES | CC(C)(C)C1CCOC(c2ccc3c(c2)OCCO3)CN1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,3)16-6-7-19-15(11-18-16)12-4-5-13-14(10-12)21-9-8-20-13/h4-5,10,15-16,18H,6-9,11H2,1-3H3 |
| InChIKey | DXPADEVHVKMWNI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |