C18H29NO2 — CID 106352888
5-tert-butyl-2-(4-propoxyphenyl)-1,4-oxazepane (PubChem CID 106352888) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-propoxyphenyl)-1,4-oxazepane.
| Compound Name | 5-tert-butyl-2-(4-propoxyphenyl)-1,4-oxazepane |
|---|---|
| PubChem CID | 106352888 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 5-tert-butyl-2-(4-propoxyphenyl)-1,4-oxazepane |
| SMILES | CCCOc1ccc(C2CNC(C(C)(C)C)CCO2)cc1 |
| InChI | InChI=1S/C18H29NO2/c1-5-11-20-15-8-6-14(7-9-15)16-13-19-17(10-12-21-16)18(2,3)4/h6-9,16-17,19H,5,10-13H2,1-4H3 |
| InChIKey | VRVBELKWJLTCJQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |