C14H21NO3S — CID 66243100
2-methyl-5-(4-propoxyphenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 66243100) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 2-methyl-5-(4-propoxyphenyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 2-methyl-5-(4-propoxyphenyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 66243100 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 2-methyl-5-(4-propoxyphenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | CCCOc1ccc(C2CS(=O)(=O)C(C)CN2)cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-3-8-18-13-6-4-12(5-7-13)14-10-19(16,17)11(2)9-15-14/h4-7,11,14-15H,3,8-10H2,1-2H3 |
| InChIKey | SQBMDXVNKUOIGV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |