C16H23NO3 — CID 65101722
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-diethylmorpholine (PubChem CID 65101722) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-diethylmorpholine.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-diethylmorpholine |
|---|---|
| PubChem CID | 65101722 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-diethylmorpholine |
| SMILES | CCC1(CC)CNCC(c2ccc3c(c2)OCCO3)O1 |
| InChI | InChI=1S/C16H23NO3/c1-3-16(4-2)11-17-10-15(20-16)12-5-6-13-14(9-12)19-8-7-18-13/h5-6,9,15,17H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | OKKXIINUXKHLPK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |