About 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine
6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine (PubChem CID 65102058) has the molecular formula C16H25NO3
and a molecular weight of 279.38 g/mol. Its IUPAC name is 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine.
Molecular Properties
| Compound Name | 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine |
| PubChem CID | 65102058 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine |
| SMILES | CCC1(CC)CNCC(c2cc(OC)ccc2OC)O1 |
| InChI | InChI=1S/C16H25NO3/c1-5-16(6-2)11-17-10-15(20-16)13-9-12(18-3)7-8-14(13)19-4/h7-9,15,17H,5-6,10-11H2,1-4H3 |
| InChIKey | OQINLPQKSNBCGO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine?
The IUPAC name of 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine (CID 65102058) is 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine.
What is the SMILES notation for 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine?
The canonical SMILES for 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine is CCC1(CC)CNCC(c2cc(OC)ccc2OC)O1.
What is the InChIKey of 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine?
The InChIKey is OQINLPQKSNBCGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-5-16(6-2)11-17-10-15(20-16)13-9-12(18-3)7-8-14(13)19-4/h7-9,15,17H,5-6,10-11H2,1-4H3.
What are the key properties of 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine?
6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine has a molecular weight of 279.38 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,5-dimethoxyphenyl)-2,2-diethylmorpholine is sourced from PubChem (CID 65102058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).