C16H23NO2 — CID 82624045
1-(2,5-dimethoxyphenyl)-2-azaspiro[4.4]nonane (PubChem CID 82624045) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-azaspiro[4.4]nonane.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-azaspiro[4.4]nonane |
|---|---|
| PubChem CID | 82624045 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-azaspiro[4.4]nonane |
| SMILES | COc1ccc(OC)c(C2NCCC23CCCC3)c1 |
| InChI | InChI=1S/C16H23NO2/c1-18-12-5-6-14(19-2)13(11-12)15-16(9-10-17-15)7-3-4-8-16/h5-6,11,15,17H,3-4,7-10H2,1-2H3 |
| InChIKey | TWPNTHKRBHRTEB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |