C16H23NO3 — CID 62517905
8-(3,4-dimethoxyphenyl)-9-oxa-6-azaspiro[4.5]decane (PubChem CID 62517905) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 8-(3,4-dimethoxyphenyl)-9-oxa-6-azaspiro[4.5]decane.
| Compound Name | 8-(3,4-dimethoxyphenyl)-9-oxa-6-azaspiro[4.5]decane |
|---|---|
| PubChem CID | 62517905 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 8-(3,4-dimethoxyphenyl)-9-oxa-6-azaspiro[4.5]decane |
| SMILES | COc1ccc(C2CNC3(CCCC3)CO2)cc1OC |
| InChI | InChI=1S/C16H23NO3/c1-18-13-6-5-12(9-14(13)19-2)15-10-17-16(11-20-15)7-3-4-8-16/h5-6,9,15,17H,3-4,7-8,10-11H2,1-2H3 |
| InChIKey | XGEZQJWZXWIHOD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |