C17H24N2O2 — CID 64931054
4-(1,3-benzodioxol-5-yl)-3-methyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64931054) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-3-methyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-3-methyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64931054 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-3-methyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CC1CNC2(CCCCC2)CN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H24N2O2/c1-13-10-18-17(7-3-2-4-8-17)11-19(13)14-5-6-15-16(9-14)21-12-20-15/h5-6,9,13,18H,2-4,7-8,10-12H2,1H3 |
| InChIKey | KMJPJVUWSIYCCO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|