C16H24N2S — CID 64934883
8-methyl-9-(4-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64934883) has the molecular formula C16H24N2S and a molecular weight of 276.45 g/mol. Its IUPAC name is 8-methyl-9-(4-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-methyl-9-(4-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64934883 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 8-methyl-9-(4-methylsulfanylphenyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CSc1ccc(N2CC3(CCCC3)NCC2C)cc1 |
| InChI | InChI=1S/C16H24N2S/c1-13-11-17-16(9-3-4-10-16)12-18(13)14-5-7-15(19-2)8-6-14/h5-8,13,17H,3-4,9-12H2,1-2H3 |
| InChIKey | ODKQXSCKPLUJFB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |