C16H22Br2N2 — CID 64946246
4-(2,4-dibromophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane (PubChem CID 64946246) has the molecular formula C16H22Br2N2 and a molecular weight of 402.17 g/mol. Its IUPAC name is 4-(2,4-dibromophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-(2,4-dibromophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 64946246 |
| Molecular Formula | C16H22Br2N2 |
| Molecular Weight | 402.17 g/mol |
| Exact Mass | 400.01 |
| IUPAC Name | 4-(2,4-dibromophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CC1CNC2(CCCCC2)CN1c1ccc(Br)cc1Br |
| InChI | InChI=1S/C16H22Br2N2/c1-12-10-19-16(7-3-2-4-8-16)11-20(12)15-6-5-13(17)9-14(15)18/h5-6,9,12,19H,2-4,7-8,10-11H2,1H3 |
| InChIKey | FHJHFAJUTLVOAV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.17 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |