C16H22FIN2 — CID 79772370
4-(4-fluoro-2-iodophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane (PubChem CID 79772370) has the molecular formula C16H22FIN2 and a molecular weight of 388.27 g/mol. Its IUPAC name is 4-(4-fluoro-2-iodophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane.
| Compound Name | 4-(4-fluoro-2-iodophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79772370 |
| Molecular Formula | C16H22FIN2 |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 4-(4-fluoro-2-iodophenyl)-3-methyl-1,4-diazaspiro[5.5]undecane |
| SMILES | CC1CNC2(CCCCC2)CN1c1ccc(F)cc1I |
| InChI | InChI=1S/C16H22FIN2/c1-12-10-19-16(7-3-2-4-8-16)11-20(12)15-6-5-13(17)9-14(15)18/h5-6,9,12,19H,2-4,7-8,10-11H2,1H3 |
| InChIKey | MADZKHZGTDWKJN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|