C17H24FIN2 — CID 79762113
3-ethyl-4-(4-fluoro-2-iodophenyl)-1,4-diazaspiro[5.5]undecane (PubChem CID 79762113) has the molecular formula C17H24FIN2 and a molecular weight of 402.30 g/mol. Its IUPAC name is 3-ethyl-4-(4-fluoro-2-iodophenyl)-1,4-diazaspiro[5.5]undecane.
| Compound Name | 3-ethyl-4-(4-fluoro-2-iodophenyl)-1,4-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 79762113 |
| Molecular Formula | C17H24FIN2 |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-ethyl-4-(4-fluoro-2-iodophenyl)-1,4-diazaspiro[5.5]undecane |
| SMILES | CCC1CNC2(CCCCC2)CN1c1ccc(F)cc1I |
| InChI | InChI=1S/C17H24FIN2/c1-2-14-11-20-17(8-4-3-5-9-17)12-21(14)16-7-6-13(18)10-15(16)19/h6-7,10,14,20H,2-5,8-9,11-12H2,1H3 |
| InChIKey | VOSNKMNDEQXUTR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|