C17H26N2 — CID 64933025
8-ethyl-9-(4-methylphenyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64933025) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 8-ethyl-9-(4-methylphenyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-(4-methylphenyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64933025 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 8-ethyl-9-(4-methylphenyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCCC2)CN1c1ccc(C)cc1 |
| InChI | InChI=1S/C17H26N2/c1-3-15-12-18-17(10-4-5-11-17)13-19(15)16-8-6-14(2)7-9-16/h6-9,15,18H,3-5,10-13H2,1-2H3 |
| InChIKey | PVTXADUUBQOMCY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|