C18H27BrN2 — CID 65499291
9-(4-bromo-2,6-dimethylphenyl)-8-ethyl-6,9-diazaspiro[4.5]decane (PubChem CID 65499291) has the molecular formula C18H27BrN2 and a molecular weight of 351.33 g/mol. Its IUPAC name is 9-(4-bromo-2,6-dimethylphenyl)-8-ethyl-6,9-diazaspiro[4.5]decane.
| Compound Name | 9-(4-bromo-2,6-dimethylphenyl)-8-ethyl-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 65499291 |
| Molecular Formula | C18H27BrN2 |
| Molecular Weight | 351.33 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 9-(4-bromo-2,6-dimethylphenyl)-8-ethyl-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCCC2)CN1c1c(C)cc(Br)cc1C |
| InChI | InChI=1S/C18H27BrN2/c1-4-16-11-20-18(7-5-6-8-18)12-21(16)17-13(2)9-15(19)10-14(17)3/h9-10,16,20H,4-8,11-12H2,1-3H3 |
| InChIKey | SBUUGLLSKZBMTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.33 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |