C17H25FN2O — CID 114840965
8-ethyl-9-(4-fluoro-3-methoxyphenyl)-6,9-diazaspiro[4.5]decane (PubChem CID 114840965) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is 8-ethyl-9-(4-fluoro-3-methoxyphenyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-ethyl-9-(4-fluoro-3-methoxyphenyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 114840965 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 8-ethyl-9-(4-fluoro-3-methoxyphenyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CCC1CNC2(CCCC2)CN1c1ccc(F)c(OC)c1 |
| InChI | InChI=1S/C17H25FN2O/c1-3-13-11-19-17(8-4-5-9-17)12-20(13)14-6-7-15(18)16(10-14)21-2/h6-7,10,13,19H,3-5,8-9,11-12H2,1-2H3 |
| InChIKey | KUHQVUBASJPQGP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |