C21H20O5 — CID 51704096
(4aS,6R,11bS)-6-(1,3-benzodioxol-5-yl)-2,3,4,4a,6,11b-hexahydro-1H-[1,3]benzodioxolo[5,6-c]chromene (PubChem CID 51704096) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is (4aS,6R,11bS)-6-(1,3-benzodioxol-5-yl)-2,3,4,4a,6,11b-hexahydro-1H-[1,3]benzodioxolo[5,6-c]chromene.
| Compound Name | (4aS,6R,11bS)-6-(1,3-benzodioxol-5-yl)-2,3,4,4a,6,11b-hexahydro-1H-[1,3]benzodioxolo[5,6-c]chromene |
|---|---|
| PubChem CID | 51704096 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (4aS,6R,11bS)-6-(1,3-benzodioxol-5-yl)-2,3,4,4a,6,11b-hexahydro-1H-[1,3]benzodioxolo[5,6-c]chromene |
| SMILES | c1cc2c(cc1[C@H]1O[C@H]3CCCC[C@H]3c3cc4c(cc31)OCO4)OCO2 |
| InChI | InChI=1S/C21H20O5/c1-2-4-16-13(3-1)14-8-19-20(25-11-24-19)9-15(14)21(26-16)12-5-6-17-18(7-12)23-10-22-17/h5-9,13,16,21H,1-4,10-11H2/t13-,16-,21+/m0/s1 |
| InChIKey | WDHGTNCMVJMBMN-UYTHQXMGSA-N |
| XLogP | 4.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |