C12H12ClNO4 — CID 82092989
5-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)-1,3-oxazolidin-2-one (PubChem CID 82092989) has the molecular formula C12H12ClNO4 and a molecular weight of 269.68 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 82092989 |
| Molecular Formula | C12H12ClNO4 |
| Molecular Weight | 269.68 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-(2-chloroethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OC(c2ccc3c(c2)OCO3)CN1CCCl |
| InChI | InChI=1S/C12H12ClNO4/c13-3-4-14-6-11(18-12(14)15)8-1-2-9-10(5-8)17-7-16-9/h1-2,5,11H,3-4,6-7H2 |
| InChIKey | AYSFWXSTVFIQGO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.68 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|