C12H14ClNO3 — CID 82088828
3-(2-chloroethyl)-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 82088828) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 3-(2-chloroethyl)-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-chloroethyl)-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 82088828 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3-(2-chloroethyl)-5-(4-methoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | COc1ccc(C2CN(CCCl)C(=O)O2)cc1 |
| InChI | InChI=1S/C12H14ClNO3/c1-16-10-4-2-9(3-5-10)11-8-14(7-6-13)12(15)17-11/h2-5,11H,6-8H2,1H3 |
| InChIKey | WLABYRPSVMFHIU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|