C16H13BrO4 — CID 104950227
(4R)-2-(7-bromo-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104950227) has the molecular formula C16H13BrO4 and a molecular weight of 349.18 g/mol. Its IUPAC name is (4R)-2-(7-bromo-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-2-(7-bromo-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104950227 |
| Molecular Formula | C16H13BrO4 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | (4R)-2-(7-bromo-1,3-benzodioxol-5-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@@H]1CC(c2cc(Br)c3c(c2)OCO3)Oc2ccccc21 |
| InChI | InChI=1S/C16H13BrO4/c17-11-5-9(6-15-16(11)20-8-19-15)14-7-12(18)10-3-1-2-4-13(10)21-14/h1-6,12,14,18H,7-8H2/t12-,14?/m1/s1 |
| InChIKey | UNNUSAZCQRLXMM-PUODRLBUSA-N |
| XLogP | 3.73 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |