C12H10ClNO2S — CID 107126193
(4S)-2-(5-chloro-1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 107126193) has the molecular formula C12H10ClNO2S and a molecular weight of 267.74 g/mol. Its IUPAC name is (4S)-2-(5-chloro-1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4S)-2-(5-chloro-1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 107126193 |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.74 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | (4S)-2-(5-chloro-1,3-thiazol-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@H]1CC(c2ncc(Cl)s2)Oc2ccccc21 |
| InChI | InChI=1S/C12H10ClNO2S/c13-11-6-14-12(17-11)10-5-8(15)7-3-1-2-4-9(7)16-10/h1-4,6,8,10,15H,5H2/t8-,10?/m0/s1 |
| InChIKey | OFMNYXNGHZUQDO-PEHGTWAWSA-N |
| XLogP | 3.35 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.74 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |