C13H11BrO2S — CID 114714985
2-(5-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714985) has the molecular formula C13H11BrO2S and a molecular weight of 311.20 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(5-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714985 |
| Molecular Formula | C13H11BrO2S |
| Molecular Weight | 311.20 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(c2ccc(Br)s2)Oc2ccccc21 |
| InChI | InChI=1S/C13H11BrO2S/c14-13-6-5-12(17-13)11-7-9(15)8-3-1-2-4-10(8)16-11/h1-6,9,11,15H,7H2 |
| InChIKey | AVAXBPWLPQAAQG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.20 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |