C13H10BrFO2S — CID 114715828
2-(5-bromothiophen-2-yl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114715828) has the molecular formula C13H10BrFO2S and a molecular weight of 329.19 g/mol. Its IUPAC name is 2-(5-bromothiophen-2-yl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 2-(5-bromothiophen-2-yl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114715828 |
| Molecular Formula | C13H10BrFO2S |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 2-(5-bromothiophen-2-yl)-7-fluoro-3,4-dihydro-2H-chromen-4-ol |
| SMILES | OC1CC(c2ccc(Br)s2)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C13H10BrFO2S/c14-13-4-3-12(18-13)11-6-9(16)8-2-1-7(15)5-10(8)17-11/h1-5,9,11,16H,6H2 |
| InChIKey | HJLWCVXWOXOARL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |