About (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine
(4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104946152) has the molecular formula C17H19NO
and a molecular weight of 253.35 g/mol. Its IUPAC name is (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine.
Molecular Properties
| Compound Name | (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine |
| PubChem CID | 104946152 |
| Molecular Formula | C17H19NO |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.15 |
| IUPAC Name | (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC(c1ccccc1)C1C[C@@H](N)c2ccccc2O1 |
| InChI | InChI=1S/C17H19NO/c1-12(13-7-3-2-4-8-13)17-11-15(18)14-9-5-6-10-16(14)19-17/h2-10,12,15,17H,11,18H2,1H3/t12?,15-,17?/m1/s1 |
| InChIKey | MISVSRCLENPXFK-YAJUMTOWSA-N |
| XLogP | 3.64 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine?
The IUPAC name of (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine (CID 104946152) is (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine.
What is the SMILES notation for (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine?
The canonical SMILES for (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine is CC(c1ccccc1)C1C[C@@H](N)c2ccccc2O1.
What is the InChIKey of (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine?
The InChIKey is MISVSRCLENPXFK-YAJUMTOWSA-N. The full InChI is InChI=1S/C17H19NO/c1-12(13-7-3-2-4-8-13)17-11-15(18)14-9-5-6-10-16(14)19-17/h2-10,12,15,17H,11,18H2,1H3/t12?,15-,17?/m1/s1.
What are the key properties of (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine?
(4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine has a molecular weight of 253.35 g/mol, XLogP of 3.64, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2-(1-phenylethyl)-3,4-dihydro-2H-chromen-4-amine is sourced from PubChem (CID 104946152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).