C10H14ClNO — CID 122360387
2-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride (PubChem CID 122360387) has the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride.
| Compound Name | 2-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
|---|---|
| PubChem CID | 122360387 |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.68 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-methyl-3,4-dihydro-2H-chromen-4-amine;hydrochloride |
| SMILES | CC1CC(N)c2ccccc2O1.Cl |
| InChI | InChI=1S/C10H13NO.ClH/c1-7-6-9(11)8-4-2-3-5-10(8)12-7;/h2-5,7,9H,6,11H2,1H3;1H |
| InChIKey | NUXKGXORZZZDFX-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.68 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |