C11H15NO3S — CID 165409949
[(2R,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide (PubChem CID 165409949) has the molecular formula C11H15NO3S and a molecular weight of 241.31 g/mol. Its IUPAC name is [(2R,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide.
| Compound Name | [(2R,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 165409949 |
| Molecular Formula | C11H15NO3S |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | [(2R,4R)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methanesulfonamide |
| SMILES | C[C@@H]1C[C@@H](CS(N)(=O)=O)c2ccccc2O1 |
| InChI | InChI=1S/C11H15NO3S/c1-8-6-9(7-16(12,13)14)10-4-2-3-5-11(10)15-8/h2-5,8-9H,6-7H2,1H3,(H2,12,13,14)/t8-,9+/m1/s1 |
| InChIKey | ORVQAHNZBHJCTJ-BDAKNGLRSA-N |
| XLogP | 1.23 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |