C11H15NOS — CID 165409808
S-[[(2S,4S)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methyl]thiohydroxylamine (PubChem CID 165409808) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is S-[[(2S,4S)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methyl]thiohydroxylamine.
| Compound Name | S-[[(2S,4S)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methyl]thiohydroxylamine |
|---|---|
| PubChem CID | 165409808 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | S-[[(2S,4S)-2-methyl-3,4-dihydro-2H-chromen-4-yl]methyl]thiohydroxylamine |
| SMILES | C[C@H]1C[C@H](CSN)c2ccccc2O1 |
| InChI | InChI=1S/C11H15NOS/c1-8-6-9(7-14-12)10-4-2-3-5-11(10)13-8/h2-5,8-9H,6-7,12H2,1H3/t8-,9+/m0/s1 |
| InChIKey | WEDCMPAMEGHJNR-DTWKUNHWSA-N |
| XLogP | 2.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|