C13H20N2O3S — CID 104524113
3-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propane-1-sulfonamide (PubChem CID 104524113) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is 3-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 104524113 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]propane-1-sulfonamide |
| SMILES | CC1COc2ccccc2C1NCCCS(N)(=O)=O |
| InChI | InChI=1S/C13H20N2O3S/c1-10-9-18-12-6-3-2-5-11(12)13(10)15-7-4-8-19(14,16)17/h2-3,5-6,10,13,15H,4,7-9H2,1H3,(H2,14,16,17) |
| InChIKey | BEZCXOVJHUZQMW-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|