C18H21NO2 — CID 104524065
4-[2-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol (PubChem CID 104524065) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[2-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol.
| Compound Name | 4-[2-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 104524065 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[2-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol |
| SMILES | CC1COc2ccccc2C1NCCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-13-12-21-17-5-3-2-4-16(17)18(13)19-11-10-14-6-8-15(20)9-7-14/h2-9,13,18-20H,10-12H2,1H3 |
| InChIKey | NIKRJAXRZSMCHX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |