C18H21NO2 — CID 104523999
3-[1-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol (PubChem CID 104523999) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[1-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol.
| Compound Name | 3-[1-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol |
|---|---|
| PubChem CID | 104523999 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-[1-[(3-methyl-3,4-dihydro-2H-chromen-4-yl)amino]ethyl]phenol |
| SMILES | CC(NC1c2ccccc2OCC1C)c1cccc(O)c1 |
| InChI | InChI=1S/C18H21NO2/c1-12-11-21-17-9-4-3-8-16(17)18(12)19-13(2)14-6-5-7-15(20)10-14/h3-10,12-13,18-20H,11H2,1-2H3 |
| InChIKey | GXGNKKRYPKXZBX-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |