C15H23NO — CID 104523746
3-methyl-N-pentan-2-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104523746) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 3-methyl-N-pentan-2-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 3-methyl-N-pentan-2-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104523746 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 3-methyl-N-pentan-2-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCCC(C)NC1c2ccccc2OCC1C |
| InChI | InChI=1S/C15H23NO/c1-4-7-12(3)16-15-11(2)10-17-14-9-6-5-8-13(14)15/h5-6,8-9,11-12,15-16H,4,7,10H2,1-3H3 |
| InChIKey | KBNIKWGEELTCDI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |