C13H18FNO — CID 104947666
(4S)-2-butan-2-yl-7-fluoro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947666) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is (4S)-2-butan-2-yl-7-fluoro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-2-butan-2-yl-7-fluoro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947666 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (4S)-2-butan-2-yl-7-fluoro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCC(C)C1C[C@H](N)c2ccc(F)cc2O1 |
| InChI | InChI=1S/C13H18FNO/c1-3-8(2)12-7-11(15)10-5-4-9(14)6-13(10)16-12/h4-6,8,11-12H,3,7,15H2,1-2H3/t8?,11-,12?/m0/s1 |
| InChIKey | NDQFFTFXTVMXNJ-HBWJCNCUSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |