C14H20BrNO — CID 104945654
(4S)-7-bromo-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104945654) has the molecular formula C14H20BrNO and a molecular weight of 298.22 g/mol. Its IUPAC name is (4S)-7-bromo-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-7-bromo-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104945654 |
| Molecular Formula | C14H20BrNO |
| Molecular Weight | 298.22 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (4S)-7-bromo-2-pentan-3-yl-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CCC(CC)C1C[C@H](N)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C14H20BrNO/c1-3-9(4-2)13-8-12(16)11-6-5-10(15)7-14(11)17-13/h5-7,9,12-13H,3-4,8,16H2,1-2H3/t12-,13?/m0/s1 |
| InChIKey | VUYISNDSVGXHSG-UEWDXFNNSA-N |
| XLogP | 4.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.22 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |